CAS 64544-24-7 appears in our catalog under these names: Moclobemide N-Oxide, 4-Chloro-N-[2-(4-oxido-4-morpholinyl)ethyl]benzamide, 98%, 98%. Offered by: TRC, Mikromol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 5mg, 100 mg, 10 mg.
4-chloro-N-[2-(4-oxidomorpholin-4-ium-4-yl)ethyl]benzamide (CAS 64544-24-7) is a chemical compound with the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. IUPAC name: 4-chloro-N-[2-(4-oxidomorpholin-4-ium-4-yl)ethyl]benzamide. InChIKey: CJTZZADPEGGIMM-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN2O3 |
|---|---|
| Molecular weight | 284.74 g/mol |
| IUPAC name | 4-chloro-N-[2-(4-oxidomorpholin-4-ium-4-yl)ethyl]benzamide |
| InChIKey | CJTZZADPEGGIMM-UHFFFAOYSA-N |
| SMILES | C1COCC[N+]1(CCNC(=O)C2=CC=C(C=C2)Cl)[O-] |
Computed by PubChem (NCBI)