CAS 6463-41-8 is the registry number for 1-(3-Chlorophenyl)-4,5-dihydro-1H-pyrazol-3-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(3-chlorophenyl)-3,4-dihydropyrazol-5-amine (CAS 6463-41-8) is a chemical compound with the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. IUPAC name: 2-(3-chlorophenyl)-3,4-dihydropyrazol-5-amine. InChIKey: BBHIPBFRTBIKAC-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3 |
|---|---|
| Molecular weight | 195.65 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-3,4-dihydropyrazol-5-amine |
| InChIKey | BBHIPBFRTBIKAC-UHFFFAOYSA-N |
| SMILES | C1CN(N=C1N)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)