CAS 64688-68-2 appears in our catalog under these names: 2-Methyl-5-nitrobenzoyl chloride 98%, 2-Methyl-5-nitrobenzoyl chloride, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-methyl-5-nitrobenzoyl chloride (CAS 64688-68-2) is a chemical compound with the molecular formula C8H6ClNO3 and a molecular weight of 199.59 g/mol. IUPAC name: 2-methyl-5-nitrobenzoyl chloride. InChIKey: IZBCECJKBKJUIM-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO3 |
|---|---|
| Molecular weight | 199.59 g/mol |
| IUPAC name | 2-methyl-5-nitrobenzoyl chloride |
| InChIKey | IZBCECJKBKJUIM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])C(=O)Cl |
Computed by PubChem (NCBI)