CAS 64704-17-2 is the registry number for Celecoxib Impurity 66. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Propan-2-yl 4-acetamidobenzenesulfonate (CAS 64704-17-2) is a chemical compound with the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. IUPAC name: propan-2-yl 4-acetamidobenzenesulfonate. InChIKey: VWKXFQOHZGOOFN-UHFFFAOYSA-N.
| Molecular formula | C11H15NO4S |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | propan-2-yl 4-acetamidobenzenesulfonate |
| InChIKey | VWKXFQOHZGOOFN-UHFFFAOYSA-N |
| SMILES | CC(C)OS(=O)(=O)C1=CC=C(C=C1)NC(=O)C |
Computed by PubChem (NCBI)