Products 64761-66-6
CAS 64761-66-6 is the registry number for Olivanic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(E)-2-aminoethenyl]sulfanyl-6-(1-hydroxyethyl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (CAS 64761-66-6) is a chemical compound with the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. IUPAC name: 3-[(E)-2-aminoethenyl]sulfanyl-6-(1-hydroxyethyl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid. InChIKey: HFTVKHFILHLXJF-NSCUHMNNSA-N.
| Molecular formula | C11H14N2O4S |
|---|---|
| Molecular weight | 270.31 g/mol |
| IUPAC name | 3-[(E)-2-aminoethenyl]sulfanyl-6-(1-hydroxyethyl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| InChIKey | HFTVKHFILHLXJF-NSCUHMNNSA-N |
| SMILES | CC(C1C2CC(=C(N2C1=O)C(=O)O)S/C=C/N)O |
Computed by PubChem (NCBI)
Synonyms:
olivanic acid