CAS 64775-97-9 appears in our catalog under these names: Spiro(3.3)heptane-2,2-dicarboxylic acid, 95%, Spiro(3.3)heptane-2,2-dicarboxylic acid, spiro[3.3]heptane-2,2-dicarboxylic acid, 95%, 95%, SPIRO[3.3]HEPTANE-2,2-DICARBOXYLIC ACID, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 0,5g, 50mg, 100mg, 250mg.
Spiro[3.3]heptane-2,2-dicarboxylic acid (CAS 64775-97-9) is a chemical compound with the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. IUPAC name: spiro[3.3]heptane-2,2-dicarboxylic acid. InChIKey: OSNPFTFAUNVQMS-UHFFFAOYSA-N.
| Molecular formula | C9H12O4 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | spiro[3.3]heptane-2,2-dicarboxylic acid |
| InChIKey | OSNPFTFAUNVQMS-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CC(C2)(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)