CAS 6501-79-7 is the registry number for 6-Chloro-7-methoxy-2,3-dihydro-1H-indole-2,3-dione. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
6-chloro-7-methoxy-1H-indole-2,3-dione (CAS 6501-79-7) is a chemical compound with the molecular formula C9H6ClNO3 and a molecular weight of 211.60 g/mol. IUPAC name: 6-chloro-7-methoxy-1H-indole-2,3-dione. InChIKey: WINIDLWIIZXCJC-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO3 |
|---|---|
| Molecular weight | 211.60 g/mol |
| IUPAC name | 6-chloro-7-methoxy-1H-indole-2,3-dione |
| InChIKey | WINIDLWIIZXCJC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC2=C1NC(=O)C2=O)Cl |
Computed by PubChem (NCBI)