CAS 65055-17-6 appears in our catalog under these names: 3–Chloro–4–fluorobenzoyl Chloride, 3-Chloro-4-fluorobenzoyl Chloride, >98.0%(GC)(T), 3-Chloro-4-fluorobenzoyl chloride, 3-Chloro-4-fluorobenzoyl chloride 98%, 3-Chloro-4-Fluorobenzoyl Chloride, 98%, 98%. Offered by: GLPBio, TCI, Biosynth, Ambeed, Chemat. Available pack sizes: 100g, 25g, 5g, 250g, 1g, 500g.
3-chloro-4-fluorobenzoyl chloride (CAS 65055-17-6) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 3-chloro-4-fluorobenzoyl chloride. InChIKey: DLZUHSFUBZTBQZ-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO |
|---|---|
| Molecular weight | 193.00 g/mol |
| IUPAC name | 3-chloro-4-fluorobenzoyl chloride |
| InChIKey | DLZUHSFUBZTBQZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)Cl)Cl)F |
Computed by PubChem (NCBI)