Products 651326-73-7
CAS 651326-73-7 appears in our catalog under these names: (6-Bromo-2,3,4-trifluorophenyl)methanol, 97%, (6-Bromo-2,3,4-trifluorophenyl)methanol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
(6-bromo-2,3,4-trifluorophenyl)methanol (CAS 651326-73-7) is a chemical compound with the molecular formula C7H4BrF3O and a molecular weight of 241.00 g/mol. IUPAC name: (6-bromo-2,3,4-trifluorophenyl)methanol. InChIKey: BNIXKLPDUMIALR-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3O |
|---|---|
| Molecular weight | 241.00 g/mol |
| IUPAC name | (6-bromo-2,3,4-trifluorophenyl)methanol |
| InChIKey | BNIXKLPDUMIALR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)CO)F)F)F |
Computed by PubChem (NCBI)
Synonyms:
(6-Bromo-2,3,4-trifluorophenyl)methanol