CAS 65136-83-6 is the registry number for 5-Chloro-2-methyl-(1,2,4)triazolo(1,5-c)quinazoline, 95%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
5-chloro-2-methyl-[1,2,4]triazolo[1,5-c]quinazoline (CAS 65136-83-6) is a chemical compound with the molecular formula C10H7ClN4 and a molecular weight of 218.64 g/mol. IUPAC name: 5-chloro-2-methyl-[1,2,4]triazolo[1,5-c]quinazoline. InChIKey: OTLFXEHWBDUICO-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN4 |
|---|---|
| Molecular weight | 218.64 g/mol |
| IUPAC name | 5-chloro-2-methyl-[1,2,4]triazolo[1,5-c]quinazoline |
| InChIKey | OTLFXEHWBDUICO-UHFFFAOYSA-N |
| SMILES | CC1=NN2C(=N1)C3=CC=CC=C3N=C2Cl |
Computed by PubChem (NCBI)