CAS 67458-38-2 appears in our catalog under these names: 6-Chloro-3-Methyl-(1,2,4)triazolo(3,4-a)phthalazine, 98+%, 6-Chloro-3-methyl-(1,2,4)triazolo(3,4-a)-phthalazine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 2,5g, 250mg.
6-chloro-3-methyl-[1,2,4]triazolo[3,4-a]phthalazine (CAS 67458-38-2) is a chemical compound with the molecular formula C10H7ClN4 and a molecular weight of 218.64 g/mol. IUPAC name: 6-chloro-3-methyl-[1,2,4]triazolo[3,4-a]phthalazine. InChIKey: KBOSDDNHLXFFIB-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN4 |
|---|---|
| Molecular weight | 218.64 g/mol |
| IUPAC name | 6-chloro-3-methyl-[1,2,4]triazolo[3,4-a]phthalazine |
| InChIKey | KBOSDDNHLXFFIB-UHFFFAOYSA-N |
| SMILES | CC1=NN=C2N1N=C(C3=CC=CC=C32)Cl |
Computed by PubChem (NCBI)