CAS 651780-27-7 is the registry number for Ethyl 6-bromobenzo(d)isoxazole-3-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 250mg.
Ethyl 6-bromo-1,2-benzoxazole-3-carboxylate (CAS 651780-27-7) is a chemical compound with the molecular formula C10H8BrNO3 and a molecular weight of 270.08 g/mol. IUPAC name: ethyl 6-bromo-1,2-benzoxazole-3-carboxylate. InChIKey: ADEQGMXEHRCMKL-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO3 |
|---|---|
| Molecular weight | 270.08 g/mol |
| IUPAC name | ethyl 6-bromo-1,2-benzoxazole-3-carboxylate |
| InChIKey | ADEQGMXEHRCMKL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC2=C1C=CC(=C2)Br |
Computed by PubChem (NCBI)