CAS 65233-46-7 is the registry number for 2-Vinyl-1,4-phenylene diacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-acetyloxy-3-ethenylphenyl) acetate (CAS 65233-46-7) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: (4-acetyloxy-3-ethenylphenyl) acetate. InChIKey: YYKHSIASTCIAPK-UHFFFAOYSA-N.
| Molecular formula | C12H12O4 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | (4-acetyloxy-3-ethenylphenyl) acetate |
| InChIKey | YYKHSIASTCIAPK-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC(=C(C=C1)OC(=O)C)C=C |
Computed by PubChem (NCBI)