Products 65237-13-0

CAS 65237-13-0 is the registry number for Ethyl 4-amino-3-phenyl-1,2-thiazole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 4-amino-3-phenyl-1,2-thiazole-5-carboxylate (CAS 65237-13-0) is a chemical compound with the molecular formula C12H12N2O2S and a molecular weight of 248.30 g/mol. IUPAC name: ethyl 4-amino-3-phenyl-1,2-thiazole-5-carboxylate. InChIKey: MLEQHRMXDILIKJ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12N2O2S
Molecular weight248.30 g/mol
IUPAC nameethyl 4-amino-3-phenyl-1,2-thiazole-5-carboxylate
InChIKeyMLEQHRMXDILIKJ-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C(=NS1)C2=CC=CC=C2)N

Computed by PubChem (NCBI)