CAS 65237-13-0 is the registry number for Ethyl 4-amino-3-phenyl-1,2-thiazole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 4-amino-3-phenyl-1,2-thiazole-5-carboxylate (CAS 65237-13-0) is a chemical compound with the molecular formula C12H12N2O2S and a molecular weight of 248.30 g/mol. IUPAC name: ethyl 4-amino-3-phenyl-1,2-thiazole-5-carboxylate. InChIKey: MLEQHRMXDILIKJ-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2S |
|---|---|
| Molecular weight | 248.30 g/mol |
| IUPAC name | ethyl 4-amino-3-phenyl-1,2-thiazole-5-carboxylate |
| InChIKey | MLEQHRMXDILIKJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=NS1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)