Products 82584-46-1
CAS 82584-46-1 is the registry number for (S)-2-Amino-3-(5-nitro-1H-indol-3-yl)propanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2S)-2-amino-3-(5-nitro-1H-indol-3-yl)propanoic acid (CAS 82584-46-1) is a chemical compound with the molecular formula C11H11N3O4 and a molecular weight of 249.22 g/mol. IUPAC name: (2S)-2-amino-3-(5-nitro-1H-indol-3-yl)propanoic acid. InChIKey: XKDUODGOACYEEU-VIFPVBQESA-N.
| Molecular formula | C11H11N3O4 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | (2S)-2-amino-3-(5-nitro-1H-indol-3-yl)propanoic acid |
| InChIKey | XKDUODGOACYEEU-VIFPVBQESA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=CN2)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)