Products 6527-33-9
CAS 6527-33-9 is the registry number for 1,3-Dimethoxy-5-(2-nitroethenyl)-2-(phenylmethoxy)benzene, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
1,3-dimethoxy-5-(2-nitroethenyl)-2-phenylmethoxybenzene (CAS 6527-33-9) is a chemical compound with the molecular formula C17H17NO5 and a molecular weight of 315.32 g/mol. IUPAC name: 1,3-dimethoxy-5-(2-nitroethenyl)-2-phenylmethoxybenzene. InChIKey: XNLXRYABLLCUPF-UHFFFAOYSA-N.
| Molecular formula | C17H17NO5 |
|---|---|
| Molecular weight | 315.32 g/mol |
| IUPAC name | 1,3-dimethoxy-5-(2-nitroethenyl)-2-phenylmethoxybenzene |
| InChIKey | XNLXRYABLLCUPF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OCC2=CC=CC=C2)OC)C=C[N+](=O)[O-] |
Computed by PubChem (NCBI)