CAS 652992-79-5 appears in our catalog under these names: 5-Phenyl-1,3-diazinane-2,4-dione, 5-Phenyldihydropyrimidine-2,4(1H,3H)-dione, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
5-phenyl-1,3-diazinane-2,4-dione (CAS 652992-79-5) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 5-phenyl-1,3-diazinane-2,4-dione. InChIKey: VGXZFNLCZWMMFI-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 5-phenyl-1,3-diazinane-2,4-dione |
| InChIKey | VGXZFNLCZWMMFI-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)NC(=O)N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)