CAS 653599-20-3 appears in our catalog under these names: Minodronic Acid Impurity 20, Minodronic Acid Impurity 14, Minodronic Acid Impurity 32. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-(2-hydroxyimidazo[1,2-a]pyridin-3-yl)acetic acid (CAS 653599-20-3) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 2-(2-hydroxyimidazo[1,2-a]pyridin-3-yl)acetic acid. InChIKey: ZKZYVBGZRKKAIW-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 2-(2-hydroxyimidazo[1,2-a]pyridin-3-yl)acetic acid |
| InChIKey | ZKZYVBGZRKKAIW-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=C(N2C=C1)CC(=O)O)O |
Computed by PubChem (NCBI)