Products 65566-69-0
CAS 65566-69-0 appears in our catalog under these names: Theobromine-d3 (7-methyl-d3), Theobromine-d3 (7-methyl-d3), 99 atom % D, min 98% Chemical Purity, Theobromine–d3, Theobromine-d3, 99.78%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 1mg, 2,5mg, 5mg, 0,01g, 0,005g, 5 mg, 1 mg.
3-methyl-7-(trideuteriomethyl)purine-2,6-dione (CAS 65566-69-0) is a chemical compound with the molecular formula C7H8N4O2 and a molecular weight of 183.18 g/mol. IUPAC name: 3-methyl-7-(trideuteriomethyl)purine-2,6-dione. InChIKey: YAPQBXQYLJRXSA-FIBGUPNXSA-N.
| Molecular formula | C7H8N4O2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | 3-methyl-7-(trideuteriomethyl)purine-2,6-dione |
| InChIKey | YAPQBXQYLJRXSA-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C=NC2=C1C(=O)NC(=O)N2C |
Computed by PubChem (NCBI)