Products 656304-77-7
CAS 656304-77-7 appears in our catalog under these names: 3-(2,4-Difluorophenyl)benzoic acid, 98%, 2',4'-Difluoro-biphenyl-3-carboxylic acid, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 500mg.
3-(2,4-difluorophenyl)benzoic acid (CAS 656304-77-7) is a chemical compound with the molecular formula C13H8F2O2 and a molecular weight of 234.20 g/mol. IUPAC name: 3-(2,4-difluorophenyl)benzoic acid. InChIKey: SFHXVEVGKASIEZ-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O2 |
|---|---|
| Molecular weight | 234.20 g/mol |
| IUPAC name | 3-(2,4-difluorophenyl)benzoic acid |
| InChIKey | SFHXVEVGKASIEZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)
Synonyms:
3-(2,4-difluorophenyl)benzoic Acid, 2',4'-Difluoro-[1,1'-biphenyl]-3-carboxylic acid, 2',4'-difluorobiphenyl-3-carboxylic acid, 2',4'-Difluoro-biphenyl-3-carboxylic acid, 2',4'-Difluoro-[1,1'-biphenyl]-3-carboxylicacid, 2',4'-Difluoro-3-biphenylcarboxylic acid, 2',4'-Difluoro[1,1'-biphenyl]-3-carboxylic acid