Products 65673-82-7
CAS 65673-82-7 appears in our catalog under these names: 4-Bromo-6-(chloromethyl)-2H-1,3-benzodioxole, 95%, 4-Bromo-6-(chloromethyl)-1,3-dioxaindane. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4-bromo-6-(chloromethyl)-1,3-benzodioxole (CAS 65673-82-7) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: 4-bromo-6-(chloromethyl)-1,3-benzodioxole. InChIKey: SJBPZFVJNASLBI-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | 4-bromo-6-(chloromethyl)-1,3-benzodioxole |
| InChIKey | SJBPZFVJNASLBI-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=CC(=C2)CCl)Br |
Computed by PubChem (NCBI)