Products 656827-74-6
CAS 656827-74-6 appears in our catalog under these names: 3-(6-Bromo-pyridin-3-yl)-acrylic acid ethyl ester, 98%, 3-(6-Bromo-pyridin-3-yl)-acrylic acid ethyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Ethyl (E)-3-(6-bromo-3-pyridinyl)prop-2-enoate (CAS 656827-74-6) is a chemical compound with the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. IUPAC name: ethyl (E)-3-(6-bromo-3-pyridinyl)prop-2-enoate. InChIKey: DTYCAISAXLAHJM-GQCTYLIASA-N.
| Molecular formula | C10H10BrNO2 |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | ethyl (E)-3-(6-bromo-3-pyridinyl)prop-2-enoate |
| InChIKey | DTYCAISAXLAHJM-GQCTYLIASA-N |
| SMILES | CCOC(=O)/C=C/C1=CN=C(C=C1)Br |
Computed by PubChem (NCBI)