CAS 657-02-3 appears in our catalog under these names: 3,4–Dichloro–5–nitrobenzotrifluoride, 3,4-Dichloro-5-nitrobenzotrifluoride 97%, 3,4-Dichloro-5-nitrobenzotrifluoride, 97%, 97%, 3,4-Dichloro-5-nitrobenzotrifluoride, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 500g, 1g, 25g, 100g, 10g.
1,2-dichloro-3-nitro-5-(trifluoromethyl)benzene (CAS 657-02-3) is a chemical compound with the molecular formula C7H2Cl2F3NO2 and a molecular weight of 259.99 g/mol. IUPAC name: 1,2-dichloro-3-nitro-5-(trifluoromethyl)benzene. InChIKey: FZHCKUHPOZBPHB-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2F3NO2 |
|---|---|
| Molecular weight | 259.99 g/mol |
| IUPAC name | 1,2-dichloro-3-nitro-5-(trifluoromethyl)benzene |
| InChIKey | FZHCKUHPOZBPHB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])Cl)Cl)C(F)(F)F |
Computed by PubChem (NCBI)