CAS 65709-23-1 appears in our catalog under these names: 3,4-(Methylenedioxy)phenylglyoxal hydrate, 97%, dry wt basis, 3,4-(Methylenedioxy)phenylglyoxal hydrate. Offered by: Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 1g, 5g, 25g, 10g, 50g.
2-(1,3-benzodioxol-5-yl)-2-oxoacetaldehyde;hydrate (CAS 65709-23-1) is a chemical compound with the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yl)-2-oxoacetaldehyde;hydrate. InChIKey: ZETZLJWJCYEROP-UHFFFAOYSA-N.
| Molecular formula | C9H8O5 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yl)-2-oxoacetaldehyde;hydrate |
| InChIKey | ZETZLJWJCYEROP-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C(=O)C=O.O |
Computed by PubChem (NCBI)