Products 30005-95-9

CAS 30005-95-9 is the registry number for 2-(5-Methylfuran-2-yl)methylidenemalonic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-[(5-methylfuran-2-yl)methylidene]propanedioic acid (CAS 30005-95-9) is a chemical compound with the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. IUPAC name: 2-[(5-methylfuran-2-yl)methylidene]propanedioic acid. InChIKey: STUYIPPGFOEHIL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8O5
Molecular weight196.16 g/mol
IUPAC name2-[(5-methylfuran-2-yl)methylidene]propanedioic acid
InChIKeySTUYIPPGFOEHIL-UHFFFAOYSA-N
SMILESCC1=CC=C(O1)C=C(C(=O)O)C(=O)O

Computed by PubChem (NCBI)