CAS 3507-08-2 appears in our catalog under these names: 5-Carboxyvanillin, min. 95 %, 2 g, 5-Formyl-2-hydroxy-3-methoxybenzoic acid, 97%, 5-Carboxyvanillin, min. 95 %, 500 mg, 5-Carboxyvanillin, 95%, 5-Carboxyvanillin, >95% (HPLC). Offered by: Roth, Ambeed, Combi-blocks, TRC, Chemat. Available pack sizes: 2g, 50mg, 1g, 5g, 10g, 500mg, 250mg, 100mg.
5-formyl-2-hydroxy-3-methoxybenzoic acid (CAS 3507-08-2) is a chemical compound with the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. IUPAC name: 5-formyl-2-hydroxy-3-methoxybenzoic acid. InChIKey: YFDQSVBNFNFXGF-UHFFFAOYSA-N.
| Molecular formula | C9H8O5 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 5-formyl-2-hydroxy-3-methoxybenzoic acid |
| InChIKey | YFDQSVBNFNFXGF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1O)C(=O)O)C=O |
Computed by PubChem (NCBI)