Products 374063-90-8
CAS 374063-90-8 appears in our catalog under these names: 4-Furan-2-yl-2,4-dioxo-butyric acid methyl ester, 95%, Methyl 4-(2-furyl)-2,4-dioxobutanoate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 5g, 250mg, 0,5g.
Methyl 4-(furan-2-yl)-2,4-dioxobutanoate (CAS 374063-90-8) is a chemical compound with the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. IUPAC name: methyl 4-(furan-2-yl)-2,4-dioxobutanoate. InChIKey: LVRDBRKWPFVTRN-UHFFFAOYSA-N.
| Molecular formula | C9H8O5 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | methyl 4-(furan-2-yl)-2,4-dioxobutanoate |
| InChIKey | LVRDBRKWPFVTRN-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)C1=CC=CO1 |
Computed by PubChem (NCBI)
Synonyms:
methyl 4-(furan-2-yl)-2,4-dioxobutanoate, 4-Furan-2-yl-2,4-dioxo-butyric acid methyl ester, methyl 4-(2-furyl)-2,4-dioxobutanoate, methyl 2,4-dioxo-4-(2-furyl)-4-ylbutanoate, 4-(2-furanyl)-2,4-dioxobutanoic acid methyl ester, Methyl 4-furan-2-yl-2,4-dioxobutyrate, Methyl 2,4-dioxo-4-(fur-2-yl)butanoate, methyl 4-(2-furyl)-2,4-dioxo-butanoate, methyl4-(furan-2-yl)-2,4-dioxobutanoate, methyl 2,4-dioxo-4-(fur-2-yl)-4-ylbutanoate