CAS 1885-13-8 appears in our catalog under these names: 4-Methoxyphthalic acid, 98%, 4–Methoxyphthalic Acid, 4-Methoxyphthalic Acid, >98.0%(GC)(T), 4-Methoxyphthalic Acid, 97%, 97%, 4-Methoxyphthalic acid, 97%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 250mg.
4-methoxyphthalic acid (CAS 1885-13-8) is a chemical compound with the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. IUPAC name: 4-methoxyphthalic acid. InChIKey: JKZSIEDAEHZAHQ-UHFFFAOYSA-N.
| Molecular formula | C9H8O5 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 4-methoxyphthalic acid |
| InChIKey | JKZSIEDAEHZAHQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)