CAS 65841-13-6 is the registry number for 3-Chloro-4,5-dimethoxybenzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-4,5-dimethoxybenzamide (CAS 65841-13-6) is a chemical compound with the molecular formula C9H10ClNO3 and a molecular weight of 215.63 g/mol. IUPAC name: 3-chloro-4,5-dimethoxybenzamide. InChIKey: GUIKIHAKNSUDTK-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO3 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | 3-chloro-4,5-dimethoxybenzamide |
| InChIKey | GUIKIHAKNSUDTK-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C(=O)N)Cl)OC |
Computed by PubChem (NCBI)