CAS 65843-60-9 appears in our catalog under these names: Salmeterol Impurity 15, Methyl 3-acetyl-4-(benzyloxy)benzoate, 97%. Offered by: Chemat Brand, AmBeed. Available pack sizes: on request, 5g.
Methyl 3-acetyl-4-phenylmethoxybenzoate (CAS 65843-60-9) is a chemical compound with the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. IUPAC name: methyl 3-acetyl-4-phenylmethoxybenzoate. InChIKey: NMUICRCYABIKOH-UHFFFAOYSA-N.
| Molecular formula | C17H16O4 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | methyl 3-acetyl-4-phenylmethoxybenzoate |
| InChIKey | NMUICRCYABIKOH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)C(=O)OC)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)