Products 65854-72-0
CAS 65854-72-0 appears in our catalog under these names: 2-Amino-5-chlorobenzophenone-d5, >95% (HPLC), 2-Amino-5-Chlorobenzophenone-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg, 50 mg.
(2-amino-5-chlorophenyl)-(2,3,4,5,6-pentadeuteriophenyl)methanone (CAS 65854-72-0) is a chemical compound with the molecular formula C13H10ClNO and a molecular weight of 236.71 g/mol. IUPAC name: (2-amino-5-chlorophenyl)-(2,3,4,5,6-pentadeuteriophenyl)methanone. InChIKey: ZUWXHHBROGLWNH-RALIUCGRSA-N.
| Molecular formula | C13H10ClNO |
|---|---|
| Molecular weight | 236.71 g/mol |
| IUPAC name | (2-amino-5-chlorophenyl)-(2,3,4,5,6-pentadeuteriophenyl)methanone |
| InChIKey | ZUWXHHBROGLWNH-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)C2=C(C=CC(=C2)Cl)N)[2H])[2H] |
Computed by PubChem (NCBI)