CAS 6594-67-8 appears in our catalog under these names: 2-((2-Chlorobenzyl)oxy)ethanamine hydrochloride, 96%, 2-((2-Chlorophenyl)methoxy)ethan-1-amine hydrochloride, {2-[(2-chlorobenzyl)oxy]ethyl}amine hydrochloride, 96%, 96%, {2-[(2-chlorobenzyl)oxy]ethyl}amine hydrochloride, 96%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 10g, 5g, 0,5g, 250mg, 1g.
2-[(2-chlorophenyl)methoxy]ethanamine;hydrochloride (CAS 6594-67-8) is a chemical compound with the molecular formula C9H13Cl2NO and a molecular weight of 222.11 g/mol. IUPAC name: 2-[(2-chlorophenyl)methoxy]ethanamine;hydrochloride. InChIKey: FRIRXRYZWDEJDY-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2NO |
|---|---|
| Molecular weight | 222.11 g/mol |
| IUPAC name | 2-[(2-chlorophenyl)methoxy]ethanamine;hydrochloride |
| InChIKey | FRIRXRYZWDEJDY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COCCN)Cl.Cl |
Computed by PubChem (NCBI)