CAS 659731-18-7 appears in our catalog under these names: 3–(Pyrrolidino)phenylboronic acid, 3-(Pyrrolidino)phenylboronic acid, 97%, 97%, 3-(Pyrrolidino)phenylboronic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
(3-pyrrolidin-1-ylphenyl)boronic acid (CAS 659731-18-7) is a chemical compound with the molecular formula C10H14BNO2 and a molecular weight of 191.04 g/mol. IUPAC name: (3-pyrrolidin-1-ylphenyl)boronic acid. InChIKey: OADUVPSZJLNMCG-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO2 |
|---|---|
| Molecular weight | 191.04 g/mol |
| IUPAC name | (3-pyrrolidin-1-ylphenyl)boronic acid |
| InChIKey | OADUVPSZJLNMCG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)N2CCCC2)(O)O |
Computed by PubChem (NCBI)