CAS 660416-42-2 appears in our catalog under these names: 3-(3-(Chloromethyl)-1,2,4-oxadiazol-5-yl)-5-methylpyridine, 95%, 3-(3-(Chloromethyl)-1,2,4-oxadiazol-5-yl)-5-methylpyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(chloromethyl)-5-(5-methyl-3-pyridinyl)-1,2,4-oxadiazole (CAS 660416-42-2) is a chemical compound with the molecular formula C9H8ClN3O and a molecular weight of 209.63 g/mol. IUPAC name: 3-(chloromethyl)-5-(5-methyl-3-pyridinyl)-1,2,4-oxadiazole. InChIKey: RTXFIZHCCUCXHN-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 3-(chloromethyl)-5-(5-methyl-3-pyridinyl)-1,2,4-oxadiazole |
| InChIKey | RTXFIZHCCUCXHN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1)C2=NC(=NO2)CCl |
Computed by PubChem (NCBI)