Products 6624-49-3
CAS 6624-49-3 appears in our catalog under these names: 3-Isoquinolinecarboxylic acid, Isoquinoline–3–carboxylic Acid, 3-Isoquinolinecarboxylic acid, 99.99%, Isoquinoline-3-carboxylic acid, 97%, Isoquinoline-3-carboxylic acid, 98%. Offered by: Biosynth, GLPBio, MedChemExpress, Thermo Scientific (Acros), Fluorochem. Available pack sizes: 25g, 1g, 10g, 5g, 5 g, 25 g, 10 g, 100g.
Isoquinoline-3-carboxylic acid (CAS 6624-49-3) is a chemical compound with the molecular formula C10H7NO2 and a molecular weight of 173.17 g/mol. IUPAC name: isoquinoline-3-carboxylic acid. InChIKey: KVMMIDQDXZOPAB-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | isoquinoline-3-carboxylic acid |
| InChIKey | KVMMIDQDXZOPAB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=NC(=CC2=C1)C(=O)O |
Computed by PubChem (NCBI)