CAS 66346-59-6 appears in our catalog under these names: 5,7-Dihydroxy-4-propyl-2h-chromen-2-one, 95%, 5,7-Dihydroxy-4-propyl-2H-chromen-2-one. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 200mg.
5,7-dihydroxy-4-propylchromen-2-one (CAS 66346-59-6) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: 5,7-dihydroxy-4-propylchromen-2-one. InChIKey: HDPADVKOPBBPJW-UHFFFAOYSA-N.
| Molecular formula | C12H12O4 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 5,7-dihydroxy-4-propylchromen-2-one |
| InChIKey | HDPADVKOPBBPJW-UHFFFAOYSA-N |
| SMILES | CCCC1=CC(=O)OC2=CC(=CC(=C12)O)O |
Computed by PubChem (NCBI)