Products 66568-97-6
CAS 66568-97-6 appears in our catalog under these names: Tsugafolin, Tsugafolin, 95%. Offered by: Biosynth, MedChemExpress, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 1 mg, 5 mg, 1mg.
(2S)-7-hydroxy-5-methoxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one (CAS 66568-97-6) is a chemical compound with the molecular formula C17H16O5 and a molecular weight of 300.30 g/mol. IUPAC name: (2S)-7-hydroxy-5-methoxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one. InChIKey: KFGFEKHSEPSVNO-AWEZNQCLSA-N.
| Molecular formula | C17H16O5 |
|---|---|
| Molecular weight | 300.30 g/mol |
| IUPAC name | (2S)-7-hydroxy-5-methoxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
| InChIKey | KFGFEKHSEPSVNO-AWEZNQCLSA-N |
| SMILES | COC1=CC=C(C=C1)[C@@H]2CC(=O)C3=C(O2)C=C(C=C3OC)O |
Computed by PubChem (NCBI)