CAS 66616-72-6 appears in our catalog under these names: 5-Phenyl-1H-indole, 95-<97%, 5-Phenyl-1H-indole, 5-Phenyl-1H-indole 95%, 5-Phenyl-1H-indole, 98%. Offered by: Hoffman Fine Chemicals, Biosynth, Ambeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 250mg, 2,5g, 100mg, 1g.
5-phenyl-1H-indole (CAS 66616-72-6) is a chemical compound with the molecular formula C14H11N and a molecular weight of 193.24 g/mol. IUPAC name: 5-phenyl-1H-indole. InChIKey: LPYXADUZSWBHCT-UHFFFAOYSA-N.
| Molecular formula | C14H11N |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 5-phenyl-1H-indole |
| InChIKey | LPYXADUZSWBHCT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(C=C2)NC=C3 |
Computed by PubChem (NCBI)