CAS 66659-65-2 appears in our catalog under these names: 1,2–bis(3–fluorophenyl)–2–hydroxyethanone, 1,2-bis(3-fluorophenyl)-2-hydroxyethanone. Offered by: GLPBio, Chemat. Available pack sizes: 100g, 25g, 5g.
1,2-bis(3-fluorophenyl)-2-hydroxyethanone (CAS 66659-65-2) is a chemical compound with the molecular formula C14H10F2O2 and a molecular weight of 248.22 g/mol. IUPAC name: 1,2-bis(3-fluorophenyl)-2-hydroxyethanone. InChIKey: AELVPDSJUJGTJH-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O2 |
|---|---|
| Molecular weight | 248.22 g/mol |
| IUPAC name | 1,2-bis(3-fluorophenyl)-2-hydroxyethanone |
| InChIKey | AELVPDSJUJGTJH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(C(=O)C2=CC(=CC=C2)F)O |
Computed by PubChem (NCBI)