Products 666732-63-4
CAS 666732-63-4 is the registry number for 6-Bromo-8-fluoro-3,4-dihydronaphthalen-1(2H)-one, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-bromo-8-fluoro-3,4-dihydro-2H-naphthalen-1-one (CAS 666732-63-4) is a chemical compound with the molecular formula C10H8BrFO and a molecular weight of 243.07 g/mol. IUPAC name: 6-bromo-8-fluoro-3,4-dihydro-2H-naphthalen-1-one. InChIKey: MCSLGRVHUSJFHG-UHFFFAOYSA-N.
| Molecular formula | C10H8BrFO |
|---|---|
| Molecular weight | 243.07 g/mol |
| IUPAC name | 6-bromo-8-fluoro-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | MCSLGRVHUSJFHG-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)C(=CC(=C2)Br)F |
Computed by PubChem (NCBI)