CAS 667413-00-5 appears in our catalog under these names: 2-(2,4-Difluorophenoxy)-2-methylpropanoic acid, 95%, 2-(2,4-Difluorophenoxy)-2-methylpropanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 0,25g.
2-(2,4-difluorophenoxy)-2-methylpropanoic acid (CAS 667413-00-5) is a chemical compound with the molecular formula C10H10F2O3 and a molecular weight of 216.18 g/mol. IUPAC name: 2-(2,4-difluorophenoxy)-2-methylpropanoic acid. InChIKey: LUUNNYIKQOANCC-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O3 |
|---|---|
| Molecular weight | 216.18 g/mol |
| IUPAC name | 2-(2,4-difluorophenoxy)-2-methylpropanoic acid |
| InChIKey | LUUNNYIKQOANCC-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)OC1=C(C=C(C=C1)F)F |
Computed by PubChem (NCBI)