Products 669051-20-1

CAS 669051-20-1 is the registry number for 5-Bromo-4-(methoxymethyl)benzo[d][1,3]dioxole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

5-bromo-4-(methoxymethyl)-1,3-benzodioxole (CAS 669051-20-1) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 5-bromo-4-(methoxymethyl)-1,3-benzodioxole. InChIKey: HHKYJPJLSXPQPI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9BrO3
Molecular weight245.07 g/mol
IUPAC name5-bromo-4-(methoxymethyl)-1,3-benzodioxole
InChIKeyHHKYJPJLSXPQPI-UHFFFAOYSA-N
SMILESCOCC1=C(C=CC2=C1OCO2)Br

Computed by PubChem (NCBI)