Products 66949-81-3
CAS 66949-81-3 appears in our catalog under these names: 9-Chloro-7-fluoro-1,2,3,4-tetrahydroacridine, 97%, 9-Chloro-7-fluoro-1,2,3,4-tetrahydroacridine, 98%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
9-chloro-7-fluoro-1,2,3,4-tetrahydroacridine (CAS 66949-81-3) is a chemical compound with the molecular formula C13H11ClFN and a molecular weight of 235.68 g/mol. IUPAC name: 9-chloro-7-fluoro-1,2,3,4-tetrahydroacridine. InChIKey: RPANWYSQFQHEEP-UHFFFAOYSA-N.
| Molecular formula | C13H11ClFN |
|---|---|
| Molecular weight | 235.68 g/mol |
| IUPAC name | 9-chloro-7-fluoro-1,2,3,4-tetrahydroacridine |
| InChIKey | RPANWYSQFQHEEP-UHFFFAOYSA-N |
| SMILES | C1CCC2=NC3=C(C=C(C=C3)F)C(=C2C1)Cl |
Computed by PubChem (NCBI)