CAS 66961-19-1 appears in our catalog under these names: 2-(2-Nitrophenoxy)benzaldehyde, 95%, 2-(2-Nitrophenoxy)benzaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
2-(2-nitrophenoxy)benzaldehyde (CAS 66961-19-1) is a chemical compound with the molecular formula C13H9NO4 and a molecular weight of 243.21 g/mol. IUPAC name: 2-(2-nitrophenoxy)benzaldehyde. InChIKey: GJXQFZNGTPPSPV-UHFFFAOYSA-N.
| Molecular formula | C13H9NO4 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | 2-(2-nitrophenoxy)benzaldehyde |
| InChIKey | GJXQFZNGTPPSPV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)OC2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)