Products 66966-07-2
CAS 66966-07-2 appears in our catalog under these names: (2R,3S,4R,5S,6S)-6-(Acetoxymethyl)tetrahydro-2H-pyran-2,3,4,5-tetrayl tetraacetate, 95%, 95%, β-L-Glucose pentaacetate. Offered by: Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 1g, 5g, Get quote.
[(2S,3S,4R,5S,6R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate (CAS 66966-07-2) is a chemical compound with the molecular formula C16H22O11 and a molecular weight of 390.34 g/mol. IUPAC name: [(2S,3S,4R,5S,6R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate. InChIKey: LPTITAGPBXDDGR-QMHWVQJVSA-N.
| Molecular formula | C16H22O11 |
|---|---|
| Molecular weight | 390.34 g/mol |
| IUPAC name | [(2S,3S,4R,5S,6R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate |
| InChIKey | LPTITAGPBXDDGR-QMHWVQJVSA-N |
| SMILES | CC(=O)OC[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)