CAS 669713-87-5 appears in our catalog under these names: (4'-Chloro-biphenyl-2-yl)acetic acid, 95%, 2-(4'-Chloro-(1,1'-biphenyl)-2-yl)acetic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
2-[2-(4-chlorophenyl)phenyl]acetic acid (CAS 669713-87-5) is a chemical compound with the molecular formula C14H11ClO2 and a molecular weight of 246.69 g/mol. IUPAC name: 2-[2-(4-chlorophenyl)phenyl]acetic acid. InChIKey: UWAXYNGFODQXHE-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO2 |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | 2-[2-(4-chlorophenyl)phenyl]acetic acid |
| InChIKey | UWAXYNGFODQXHE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)