Products 671188-82-2
CAS 671188-82-2 appears in our catalog under these names: Blonanserin Impurity Q, 3-(4-Fluorophenyl)-3-oxopropanamide, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-fluorophenyl)-3-oxopropanamide (CAS 671188-82-2) is a chemical compound with the molecular formula C9H8FNO2 and a molecular weight of 181.16 g/mol. IUPAC name: 3-(4-fluorophenyl)-3-oxopropanamide. InChIKey: OCMBRGOMXXXXHT-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO2 |
|---|---|
| Molecular weight | 181.16 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-3-oxopropanamide |
| InChIKey | OCMBRGOMXXXXHT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CC(=O)N)F |
Computed by PubChem (NCBI)