CAS 67173-18-6 appears in our catalog under these names: Ibuprofen Impurity 6, 3-(1-Hydroxyethyl)benzophenone, >95% (HPLC), 3-(1-Hydroxyethyl)benzophenone. Offered by: Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: on request, 100mg, 10mg, 1mg, 2mg, 5mg, 25mg.
[3-(1-hydroxyethyl)phenyl]-phenylmethanone (CAS 67173-18-6) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: [3-(1-hydroxyethyl)phenyl]-phenylmethanone. InChIKey: VIGLCJZNAGRKFZ-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | [3-(1-hydroxyethyl)phenyl]-phenylmethanone |
| InChIKey | VIGLCJZNAGRKFZ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)C(=O)C2=CC=CC=C2)O |
Computed by PubChem (NCBI)