CAS 672-99-1 appears in our catalog under these names: 4-Bromo-3,5-dimethylphenyl methylcarbamate, 95%, 4-Bromo-3,5-dimethylphenyl-n-methylcarbamate. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: on request, 100mg, 1x100mg.
(4-bromo-3,5-dimethylphenyl) N-methylcarbamate (CAS 672-99-1) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: (4-bromo-3,5-dimethylphenyl) N-methylcarbamate. InChIKey: ZOZFMTULOYRWEL-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | (4-bromo-3,5-dimethylphenyl) N-methylcarbamate |
| InChIKey | ZOZFMTULOYRWEL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Br)C)OC(=O)NC |
Computed by PubChem (NCBI)