CAS 6722-09-4 appears in our catalog under these names: Pranoprofen Impurity 22, 5H–(1)Benzopyrano(2,3–b)Pyridin–5–ol, 5H-Chromeno[2,3-b]pyridin-5-ol, 97%, 97%. Offered by: Chemat Brand, GLPBio, Chemat. Available pack sizes: on request, 250mg, 1g.
5H-chromeno[2,3-b]pyridin-5-ol (CAS 6722-09-4) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: 5H-chromeno[2,3-b]pyridin-5-ol. InChIKey: CAOGEKWDLGLKQK-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 5H-chromeno[2,3-b]pyridin-5-ol |
| InChIKey | CAOGEKWDLGLKQK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=C(O2)N=CC=C3)O |
Computed by PubChem (NCBI)